Explanation:
hydropower energy is:
-renewable
-clean (doesn't produce toxins or emit harmful gases into the atmosphere)
-environment friendly
-cheap once installed
Answer:
Dominant genes are always represented by a capital letter which in this case is the letter B whereas recessive genes will be represented by a lower case letter like b.
You only need one copy of a dominant gene or allele to inherit it. A dominant allele is always expressed even if only one copy is present.
But you need two copies of genes or alleles to inherit the recessive gene. There also can't be a dominant allele of the gene if you are to inherit this.
Allele - Different forms of a gene
The total number of elements that one particular element can bond to can be determined by simply drawing the Lewis structure of the element.
Place the chemical symbol
Then look at the group number = valence electrons
Distribute the valence electrons around the atom.
C = 4 bonds
N = 3 bonds
O = 2 bonds
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
