Answer:
Lithium Fluoride
Explanation:
It should be lithium fluoride for sure :)
Answer: There are now 2.07 moles of gas in the flask.
Explanation:
P= Pressure of the gas = 697 mmHg = 0.92 atm (760 mmHg= 1 atm)
V= Volume of gas = volume of container = ?
n = number of moles = 1.9
T = Temperature of the gas = 21°C=(21+273)K= 294 K (0°C = 273 K)
R= Value of gas constant = 0.0821 Latm\K mol
When more gas is added to the flask. The new pressure is 775 mm Hg and the temperature is now 26 °C, but the volume remains same.Thus again using ideal gas equation to find number of moles.
P= Pressure of the gas = 775 mmHg = 1.02 atm (760 mmHg= 1 atm)
V= Volume of gas = volume of container = 49.8 L
n = number of moles = ?
T = Temperature of the gas = 26°C=(26+273)K= 299 K (0°C = 273 K)
R= Value of gas constant = 0.0821 Latm\K mol
Thus the now the container contains 2.07 moles.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
The balanced chemcial equation is B. So to do single, we need to look at where would Li stand on the metals chart (For my class we have a chart to see which element is the highest on the metals chart) . So since Li is higher, F needs to go with Li, leaving Ba alone.
I hope this helps you!
Answer:
It is a covalent bond because both carbon and oxygen are nonmetals. The formula will be CO² because the electrons between the atoms are being shared equally.
