Answer:
The moles of KClO3 = 0.052 moles
Explanation:
Step 1: Calculate the pressure of oxygen gas
The oxygen has a total pressure (including water vapour) of 760 mmHg
The pressure of Oxygen = (760 - 26) mmHg
= 734 mmHg of water vapor
Step 2: Calculate the no of moles of oxygen
Using Ideal gas equation
P V = n R T
P = pressure of oxygen in N/m2 ( you should convert 734 mmHg to pascal or N/m2) = 97,858.6 N/m2 or pas
V = 2 litres = 0.002 m3
R = gas constant = 8.31
T= 27oC = 300 K
Applying this equation P V = n R T
97,858.6 x 0.002 = n x 8.31 x 300
n = 0.0785 mol of Oxygen
From the balanced equation
2 KClO 3 ---- 2 KCl + 3 O 2
3 moles of oxygen is produced from 2 moles KClO3
so 0.0785 mole of oxygen will be produced from x
x = (0.0785 x 2 ) / 3
x = 0.052 moles of KClO3
Answer:
Concentration = 1.32 m
Boiling point = 
Explanation:
Let the boiling point of two solutions = T
Let the molal concentration of the two solutions= m
The relation between elevation in boiling point and molal concentration is:
i) For benzene
....(1)
ii) For carbon tetrachloride
...(2)
Equating the two equations:
Putting value of "m" in equation "1"
Building a space station in orbit is a safety measure. If a rocket fails to bring up the entire space station in one piece it would be extremely expensive to build a new one. Bringing it up in multiple places ensures less money would be lost if the rocket fails.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
C. It is a reaction to emotion but not to maintain stability.
