Answer:
If a mineral with a density of 6 g/cm3 is broken into 3, the density of each new piece is 6 
Explanation:
Density is a quantity that allows us to measure the amount of mass in a certain volume of a substance. In other words, density is the property that matter, whether solid, liquid or gas, has to compress into a given space, the amount of mass per unit volume.
As density is a physical property of matter that is defined as the ratio of an object's mass to its volume, each material or substance has its own density regardless of its size because the ratio between mass and volume is the same.
<u><em>If a mineral with a density of 6 g/cm3 is broken into 3, the density of each new piece is 6 </em></u>
<u><em></em></u>
Answer:
I'm fairly sure it's D
Explanation:
If they're more spread out than they're roots in theory should have more space. Sorry if I'm wrong
50x75=3750 -- metres per day
3750x15=56250 -- metres in 15 days
Divide by 1000 to convert to km
56.250km
<u>56.25km</u>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
The first ionization energy for K is less than Ca because Ca has a larger effective nuclear charge.