Wavelength of the light is 2.9 × 10⁻⁷ m.
<u>Explanation:</u>
Planck - Einstein equation shows the relationship between the energy of a photon and its frequency, and they are directly proportional to each other and it is given by the equation as E = hν,
where E is the energy of the photon
h is the Planck's constant = 6.626 × 10⁻³⁴ J s
ν is the frequency
From the above equation, we can find the frequency by rearranging the equation as,
ν = 
= 
Now the frequency and the wavelength are in inverse relationship with each other.
ν × λ = c
It can be rearranged to get λ as,
λ = c / ν
= 
So wavelength is 2.9 × 10⁻⁷ m.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Hello.
<span>It makes a longitudinal wave because it stretches and compresses while as it slithers foward.
</span>
Have a nice day
Answer:
4 enzymes responsible for digestion:
1. Salivary amylase ---- substrate: Starch ---- end-product: Maltose
2. Lipase ---- substrate: Lipids (fats and oils) ---- end-product: Fatty acids and glycerol
3. Maltase ---- substrate: Maltose ---- end-product: Glucose
4. Protease ---- substrate: Protein ---- end-product: Amino acids
