Answer:
.7689 mol
15.516 g
Explanation:
Use the Ideal Gas Law, PV = nRT.
Make sure to use the correct ideal gas constant R. You can either put R in torr, or you can change the pressure to atm. I've just used the torr ideal gas constant.
481.1 torr * 29.9 L = n 62.364 LTorr/molK * 300 K
14384.89 = 18709.2n
n = <u>.7689 mol</u>
The molar mass of neon (remember that neon gas = Ne, it's not diatomic) is 20.18 g/mol from the periodic table.
.7689 mol * 20.18 g/mol = <u>15.516 g</u>
- Light energy from sun is converted into electrical energy in a solar cell.
- Electrical energy is stored as chemical energy in the solar cell.
- Chemical energy is converted back into electrical energy at night.
- Electrical energy is converted into light energy from the street lamp.
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer: D) Eight
Just pretend this part doesn't exist nope nothing to see here the answer is correct on edge2020 I swear on my brainly points
Answer:
Explanation:
Chloride is described as an extended structure because its atoms are arranged following an endless repeating pattern and are of distinct ratio
Crystals and polymers mostly form extended structures as seen in the formation of sodium chloride whereby the ions in the compound are arranged following a repeating pattern. ( i.e. has a giant ionic structure ).
Chloride is a considered an extended structure because in sodium chloride it forms an unending repeated pattern of ions which makes it a perfect example of an extended structure.
Hence we can conclude that Chloride can be described as an extended structure because its atoms are arranged following a repeating pattern and are of distinct ratio.
