Answer:
Explanation:
moler mass of Cu is 63.546 g/mol. Since 63.546 g of copper has 6.022 x 10 power(23) atoms (Avogadro's number). = 9.5 x 10(power)21 atoms of copper.
Answer:
the top of the roller coaster
Explanation:
the roller coaster at the top when it has the most potential energy reaches Peak when its going to convert into kinetic energy
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
5×10⁵ L of ammonia (NH3)
Explanation:
We'll begin by writing the balanced equation for the reaction. This is illustrated below:
N2 + 3H2 —> 2NH3
From the balanced equation above, we can say that:
3 L of H2 reacted to produce 2 L of NH3.
Finally, we shall determine the volume of ammonia (NH3) produced by the reaction of 7.5×10⁵ L of H2. This can be obtained as illustrated below:
From the balanced equation above,
3 L of H2 reacted to produce 2 L of NH3.
Therefore, 7.5×10⁵ L of H2 will react to produce = (7.5×10⁵ × 2)/3 = 5×10⁵ L of NH3.
Thus, 5×10⁵ L of ammonia (NH3) is produced from the reaction.
