Usually you just need to give it rest for 6-12 weeks. depending on how large it is surgery may be needed
I dont know what subject is this
Answer:
d. it has a high boiling point
Explanation:
all ionic compounds with ionic bonds have high boiling points
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
It’s, D. Kinetic Energy.
Explanation: Energy associated with an object’s motion is called kinetic energy. A speeding bullet, a walking person, and electromagnetic radiation like light all have kinetic energy.
Hope this helped ;)