All categories

3 years ago

ANSWER FAST PLEASE! Balance the following equation: Hg + O₂ --> __HgO

Chemistry

1 answer:

ICE Princess25 [194]3 years ago

3 0

Answer:

4Hg+2O2=4HgO

four Mercury + four oxygen

You might be interested in

Need help with Chemistry homework...

lesantik [10]

1. 3Fe + 202

2. 2Sr + 02

3. SN + 2NaOH

4. 2K + Br2

5. 2C8H18 + 25O2

6. 2Sb + 3I2

6 0

3 years ago

A tire at 21°C has a pressure of 0.82 atm. Its temperature decreases to –3.5°C. If there is no volume change in the tire, what i

Phantasy [73]

Using ideal gas equation, PV = nRT, and since there is no volume change and amount change, the equation is now P = kT, where k =nR/V. Temperature must be in kelvin From the given, k = (0.82)/ (21 + 273) = 2.78 x 10^-3 Substituting T = -3.5+273, P = 0.75 atm

7 0

3 years ago

Read 2 more answers

What are the Common compounds of niobium in which it is found

blagie [28]

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

7 0

3 years ago

If anyone knows please help ! ASAP

xeze [42]

Answer:

The answer is B

Explanation:

I know this because its right.

4 0

3 years ago

What is the volume in mL of a 1.18 carat diamond, given the density of diamond is 3.51 g/mL? (1 carat = 200 mg).

nataly862011 [7]

In order to calculate for the volume of the diamond, just first convert the given carat by multiplying it to the given conversion to weight. Since the weight that will be obtained is in milligrams convert it into grams then divide it with the density. The volume of the 1.18 carat diamond is 0.0672 ml.

3 0

3 years ago

ANSWER FAST PLEASE! Balance the following equation: __Hg + __O₂ --> __HgO

ANSWER FAST PLEASE! Balance the following equation: Hg + O₂ --> __HgO