Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
6.533 × 10^-21J
Explanation:
The energy of the microwave photon can be calculated using:
E = hf
Where;
E = energy of photon (J)
h = Planck's constant (6.626 × 10^-34 J/s)
f = frequency (9.86 x 10^12 Hz)
Hence, E = hf
E = 6.626 × 10^-34 × 9.86 x 10^12
E = 65.33 × 10^(-34 + 12)
E = 65.33 × 10^(-22)
E = 6.533 × 10^-21J
The energy of the microwave photon is
6.533 × 10^-21J
Membranes are barriers and “gatekeepers”, they only let certain molecules pass through them.
they also transport nutrients to the cell
(a)- Time
(b)- Heat produced(i guess)
(c)- Material
this is what I think, hope it helps
Answer:
1. Lysine
2. Aspartic acid
3. Serine
4. Alanine
5. Tryptophan
Explanation:
Amino acids are biomolecules that contain two functional groups and one R side chain. The two functional groups are: carboxyl group and amino group.
The α-amino acids are the amino acids in which the two functional groups and the R side chain are attached to the α-carbon of the amino acid. They are total 22 α-amino acids.
1. A basic amino acid: Lysine is a positively charged, polar basic amino acid with a lysyl side chain.
2. An acidic amino acid: Aspartic acid is a negatively charged, polar acidic amino acid with an acidic carboxymethyl group.
3. A neutral polar amino acid: Serine is a polar and neutral amino acid with a hydroxymethyl group.
4. A non-polar aliphatic amino acid: Alanine is an aliphatic, nonpolar and neutral amino acid with a methyl side chain.
5. An aromatic amino acid: Tryptophan is an aromatic, nonpolar and neutral amino acid with an indole side chain.
