Answer:
I think the right answer is c/ number of atomic orbitals
Answer: A wave
Explanation:
Because it’s the one that’s cause the new medium to go between the two media.
Answer : The molar mass of the solute would be low.
Explanation :
Formula used for depression in freezing point is:
where,
= change in freezing point
= freezing point of solution
= freezing point of water
i = Van't Hoff factor
= freezing point constant
m = molality
= mass of solute
= mass of solvent
= molar mass of solute
From the formula we conclude that, when the freezing point of the solution read incorrectly that is freezing point of the solution is lower than the true freezing point then this means that change in freezing point would be high and the molar mass of the solute would be low.
Hence, the molar mass of the solute would be low.
Answer:
A. increasing the ability of technology, like microscopes, to see even smaller particles
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
