Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
The correct answer is option A. Energy cannot be created during an ordinary chemical reaction. There is no such thing as an ordinary chemical reaction. Energy cannot be created or destroyed this is according to the law of conservation of energy. It can only be transformed from one form to another form.
First blank -Same
Second blank-Neutral
Lower than 7 is acid greater than 7 is a base
Answer:
- <u><em>butylphenyl ether.</em></u>
Explanation:
The formula of the compound is:
- CH₃ - CH₂ - CH₂ - CH₂ - O - C₆H₅
1. The functional group is of the kind R - O - R', i.e. two alkyl groups each attached to one end of the oxygen atom. That means that the compound is an ether.
2. One group attached to the oxygen group is CH₃ - CH₂ - CH₂ - CH₂ - which has 4 carbons and is named butyl group.
3. The other group attached to the oxygen atom is C₆H₅ - which is derived from ciclohexane as is known as phenyl group.
4. Using the rule of naming the subtituents in alphabetical order, you name butyl first and phenyl second, so it is <u><em>butylphenyl ether.</em></u>
