Answer:
The force then channels down through the walls to the floor. The force of the walls pushing down on the floor is exactly balanced by an equal force when the floor pushes up on the wall. ... The main, structural walls are called load-bearing walls and they're usually built from solid brick or stone.
Explanation:
Answer:
Fatty acid
Explanation:
A fatty acid is a carboxylic acid with a long chain of 12 or more carbons.
If the molecule has no other distinguishing features, the compound is hexacosanoic acid, CH₃(CH₂)₂₄COOH.
No, x-rays do not travel slower than infrared radiation or even the opposite. Both are travelling in vacuum therefore they travel at same speed. They differ in the frequency of the electromagnetic waves.
Electricity grids will produce surplus power
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
