Answer:
Explanation:
2Al(s) + Fe₂O₃(s) ⟶ Al₂O₃(s) + 2Fe(s); ΔᵣH = ?
The formula for calculating the enthalpy change of a reaction by using the enthalpies of formation of reactants and products is
2Al(s) + Fe₂O₃(s) ⟶ Al₂O₃(s) + 2Fe(s)
ΔfH°/kJ·mol⁻¹: 0 -824.3 -1675.7 0
![\begin{array}{rcl}\Delta_{\text{r}}H^{\circ} & = & [1(-1675.7) + 2(0)] - [2(0) - 1(-824.3)]\\& = & -1675.7 + 824.3\\& = & \textbf{-851.4 kJ/mol}\\\end{array}\\\text{The enthalpy change is } \large \boxed{\textbf{-851.4 kJ/mol}}](https://tex.z-dn.net/?f=%5Cbegin%7Barray%7D%7Brcl%7D%5CDelta_%7B%5Ctext%7Br%7D%7DH%5E%7B%5Ccirc%7D%20%26%20%3D%20%26%20%5B1%28-1675.7%29%20%2B%202%280%29%5D%20-%20%5B2%280%29%20-%201%28-824.3%29%5D%5C%5C%26%20%3D%20%26%20-1675.7%20%2B%20824.3%5C%5C%26%20%3D%20%26%20%5Ctextbf%7B-851.4%20kJ%2Fmol%7D%5C%5C%5Cend%7Barray%7D%5C%5C%5Ctext%7BThe%20enthalpy%20change%20is%20%7D%20%5Clarge%20%5Cboxed%7B%5Ctextbf%7B-851.4%20kJ%2Fmol%7D%7D)
Answer: I think the formula is PV=nRT and I divide both sides by RT, but this is as far as I can get in my equation before I get stumped: (751 mm Hg) (8.3 L)/ (309 K) Can you help?
Explanation:
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
The appropriate answer is a. HUNTER-GATHERER. Hunter-gatherer societies are nomadic and they forage for edible plants, bean, fruits and nuts. They also hunt wild game for food. Early humans in the Neolithic period practiced this way of life.
Agrarian societies thrive on agriculture which they depend on for sustainable and for trade. Animals and plants are domesticated and so people can settle and build a society. Pastoral agriculture is a semi-nomadic lifestyle where the society is centered around keeping herds of grazing animals. Industrial societies focus on manufacturing and this is the backbone of the society.
Answer:
C.)One electron in each p orbital
Explanation:
In a P-sublevel with 3 electrons, they should be arranged with one electron going into each p-orbitals.
This is in accordance with the Hund's rule of maximum multiplicity.
The rule states that "electrons go into degenerate orbitals or sub-levels(p,d and f) singly before paring up".
Since the p-orbital is 3-fold degenerate with a capacity to accommodate a maximum number of 6 electrons, given 3 electrons, they will follow the Hund's rule in order to fill the orbitals.
So one electron will go in each p - orbitals easily.
