Answer;
B. They are large molecules that increase the rate of biologically important reactions.
Explanation;
-Enzymes are biological molecules, that are protein in nature, that significantly speed up the rate of virtually all of the chemical reactions that take place within cells.
-They are vital for life and serve a wide range of important functions in the body, such as aiding in digestion and metabolism. Some enzymes help break large molecules into smaller pieces that are more easily absorbed by the body. Other enzymes help bind two molecules together to produce a new molecule.
Answer:
The volume of water to be added is 0.175 liters of water
Explanation:
The given concentration of the nitric acid = 55% (M/M)
The mass of the nitric acid solution = 100 gm
The concentration solution is to diluted to = 20% (M/M)
The 100 g 55%(M/M) nitric acid solution gives 55g nitric acid in 100 g of solution
Therefore, to have 20% (M/M) nitric acid solution with the 55 g nitric acid, we get
Let "x" represent the volume of the resulting solution, we have;
20% of x = 55 g of nitric acid
∴ 20/100 × x = 55 g
x = 55 g × 100/20 = 275 g
The mass of extra water to be added = The mass of the 20%(M/M) solution solution of nitric acid - The current mass of the 55%(M/M) solution of nitric acid
The mass of extra water to be added = 275 g - 100 g = 175 g
Volume = Mass/Density
The density of water ≈ 1 g/ml
∴ The volume of water to be added that gives 175 g of water = 175 g/(1 g/ml) = 175 ml. = 0.175 l
The volume of water to be added = 0.175 liters of water.
Two non metal combined together and form the bond is called covalent bond
Note - yellow color molecules in pictures are non metal elements
example - co2 , so2,
Answer:
Option-D: 2.3 × 10⁻³ mol/dm³
Explanation:
Calculate moles of ascorbic acid,
Moles = Mass / M.Mass
Moles = 0.080 g / 176 g/mol
Moles = 0.00045 mole
Also,
Molarity = Moles / Vol. in dm³
Molarity = 0.00045 mol / 0.20 dm³
Molarity = 0.00227 mol.dm⁻¹ or 2.3 × 10⁻³ mol/dm³
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
