start out as one kind of rock, but large amounts of pressure and heat change them into a different kind.

The fact that HBO2, a reactive compound, was produced rather than the relatively inert B2O3 was a factor in the discontinuation

Reil [10]

Answer:

1027.62 g

Explanation:

For $B_2H_6$ :-

Mass of $B_2H_6$ = 296.1 g

Molar mass of $B_2H_6$ = 27.66 g/mol

The formula for the calculation of moles is shown below:

$moles = \frac{Mass\ taken}{Molar\ mass}$

Thus,

$Moles= \frac{296.1\ g}{27.66\ g/mol}$

$Moles\ of\ B_2H_6= 10.705\ mol$

From the balanced reaction:-

$B_2H_6(g) + 3 O2_{(l)}\rightarrow 2 HBO_2_{(g)}+ 2 H_2O_{(l)}$

1 mole of $B_2H_6$ react with 3 moles of oxygen

Thus,

10.705 mole of $B_2H_6$ react with 3*10.705 moles of oxygen

Moles of oxygen = 32.115 moles

Molar mass of oxygen gas = 31.998 g/mol

Mass = Moles * Molar mass = 32.115 * 31.998 g = 1027.62 g

8 0

3 years ago

A basketball player jumps straight up to dunk a basketball. The basketball player's speed increases as she returns to the

katen-ka-za [31]

Options :

The upward force is greater than the downward force.

The downward force is greater than the upward force.

The rightward force is greater than the leftward force.

The leftward force is greater than the rightward force.

Answer:

The downward force is greater than the upward force.

Explanation:

When the player jumps to dunk a basket ball, it requires an upward force exerted on the person due to the push by the person to jump, after dunking the basket ball, the player attains maximum height, where his final velocity becomes zero and his direction changes (from upward to downward), at this point his velocity increases due to the additional force exerted on the player due to the Earth's Gravitational pull - which is a downward force which acts on an object).

Hence, it could be concluded that the increase in speed of the basketball player as she returns to the ground means that the downward force is greater than the upward force acting on the player.

7 0

2 years ago

As a temperature of Lava increases, ___________.

levacccp [35]

B its viscosity decreases

3 0

3 years ago

Read 2 more answers

G what is the difference between the sidechains of leucine and isoleucine? select one:

statuscvo [17]

c. Isoleucine has a carbon “branched” closer to the alpha carbon than does leucine.

The structure of leucine is CH3CH(CH3)CH2CH(NH2)COOH.

The structure of isoleucine is CH3CH2CH(CH3)CH(NH2)COOH.

In leucine, the CH3 group is two carbons away from the α carbon; in isoleucine, the CH3 group is on the carbon next to the α carbon.

Thus, isoleucine has the closer branched carbon.

“One is charged, the other is not” is incorrect. Both compounds are uncharged.

“One has more H-bond acceptors than the other” is incorrect. Each acid has two H-bond acceptors — the N in the amino and the O in the carbonyl group.

“They have different numbers of carbon atoms” is incorrect. They each contain six carbon atoms.

4 0

3 years ago

How do you draw 5 arrows showing uniformity

makkiz [27]

Answer:

I don't really know what that is so here is a picture of it

Explanation:

4 0

2 years ago