The solutions vapor pressure would be lower.
<h3>
Answer:</h3>
The Equilibrium would shift to produce more NO
<h3>
Explanation:</h3>
The reaction is;
N₂(g) + O₂(g) ⇆ 2NO(g)
- When a reaction is at equilibrium then the forward reaction rate will be equivalent to the reverse reaction rate. Additionally, the concentration of the reactants and products are the same.
- From Le Chatelier's principle, additional reactants favor the formation of more products while additional products favor the formation of more reactants.
- For example, when more oxygen is added then more Nitrogen (II) oxide will be formed.
- Oxygen is a reactant and when increased it favors forward reaction which leads to the formation of more NO which is the product.
To calculate this, we need the Molarity formula. This formula tell us that Molarity, which is a concentration unit, is equal to the number of moles divided by the volume. In this question we already have the Molarity and the Volume, so let's build our equation:
C = n/V (You can see Molarity with the letter "C" because it means concentration)
3 = n/1
n = 1 * 3
n = 3 moles of NaOH
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
What do you mean by unlock all of them? Please explain
