Answer: True
Explanation: For example, changing direction can change velocity
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Iconic bond or covalent bond
Explanation:
Answer:
The stomach
Explanation:
In the stomach, physical digestion occurs because of peristaltic contractions (wave like contraction in the lean muscle) and chemical digestion occurs because of stomach acid, hydrochloric acid, breaking down your food.
A very hot but containable and easy or legal container so it doesn't explode , thermometer but advanced so it doesn't burn and gloves maybe oven mitts and if u were doing it at home other safety equipment
