Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
For the answer to the questions above,
a) Ag2CO3(s) => Ag2O(s)+CO2(g)
<span>b) Cl2(g)+2(KI)(aq) => I2(s)+2(KCl)(aq) (coefficients are for balanced equation) </span>
<span>net ionic is Cl2(g)+2I- => I2(s)+2Cl-(aq) </span>
<span>c) I2(s)+3(Cl2)(g)=>2(ICl3)
</span>I hope I helped you with your problem
Answer:
Molecular formula = C₂H₄Cl₂
Explanation:
Molecular formula:
Molecular formula consist of symbols of elements present in compound with numbers of atoms of each element in subscript.
Empirical formula:
It is the simplest formula gives the ratio of atoms of different elements in small whole number .
Given data:
Percentage of hydrogen = 4.07%
Percentage of Cl = 71.65%
Percentage of carbon = 24.27%
Molar mass = 99 g/mol
Molecular formula = ?
Solution:
Number of gram atoms of H = 4.07 / 1.01 = 4.0
Number of gram atoms of Cl = 71.65 / 35.5 = 2.0
Number of gram atoms of C = 24.27 / 12 = 2.0
Atomic ratio:
H : C : Cl
4/2 : 2/2 : 2/2
2 : 1 : 1
C : H : Cl = 1 : 2 : 1
Empirical formula is CH₂Cl.
Molecular formula:
Molecular formula = n (empirical formula)
n = molar mass of compound / empirical formula mass
Empirical formula mass = 12+1×2+ 35.5 = 49.5
n = 99/49.5
n = 2
Molecular formula = n (empirical formula)
Molecular formula = 2 ( CH₂Cl)
Molecular formula = C₂H₄Cl₂
The number 345,000 has 3 significant figures because the trailing zeros are not significant since there's no decimal point.
<h3>What is significant figures?</h3>
Significant figures of a number in positional notation are digits in the number that are reliable and necessary to indicate the quantity of something.
Also significant figures can be defined as, the number of digits in a value, often a measurement, that contribute to the degree of accuracy of the value.
Examples of significant figures;
- 405 = 3 significant figures
- 405000 = 3 significant
- 0.040500 = 5 significant figures
<u>Note:</u> leading zeros are not significant but trailing zeros, which are zeros at the end of a number, are significant only if the number has a decimal point.
345,000 = 3.45 x 10⁵ (3 significant figures)
Thus, the number 345,000 has 3 significant figures because the trailing zeros are not significant since there's no decimal point.
Learn more about significant figures here: brainly.com/question/24491627
#SPJ1
