Answer:
M = 1.26
Explanation:
Molarity = mole of solution/liters of solution
435mL/1000 = .435L
Plugging in the numbers into the formula, we get:
Molarity = .550 mol/.435L = 1.26 M
Answer: Every chemical equation adheres to the law of conservation of mass, which states that matter cannot be created or destroyed. ...
Use coefficients of products and reactants to balance the number of atoms of an element on both sides of a chemical equation.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
oceanic formation is the right answer.
Explanation:
this os becoz they slide a past each other and do not rub against each other
Explanation:
There are several ways to define acids and bases, but pH and pOH refer to hydrogen ion concentration and hydroxide ion concentration, respectively. The "p" in pH and pOH stands for "negative logarithm of" and is used to make it easier to work with extremely large or small values. pH and pOH are only meaningful when applied to aqueous (water-based) solutions. When water dissociates it yields a hydrogen ion and a hydroxide.