distance traveled by a uniformly accelerated bike is given as

here we know that



now we will have from above equation


so it will cover the total distance of 300 m
Number three
They contain protons (positive), neutrons (negative), electrons (neutral) and all are in a nucleus which is part of an atom
Answer:
Rug burn, Indian burn done to you by a friend, friction from the road causes your car to accelerate at a slower rate, The cylinder heads in an engine, When trying to move a heavy object across a rough surface
Explanation:
Answer:

Explanation:
Given: that,
Angle of inclination of the surface, 
mass of the crate, 
Force applied along the surface, 
distance the crate moves after the application of force, 
a) work done = F× s
work done = 230 × 1.1
work done = 253 J
b) Work done by the gravitational force:

where:
g = acceleration due to gravity
h = the vertically downward displacement
Now, we find the height:

So, the work done by the gravity:

∵direction of force and displacement are opposite.
= - 343.54J
c)
The normal reaction force on the crate by the inclined surface:

d)
Total work done on crate is with respect to the worker:

C = 5/9 (F-32)Part 1. C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit