•It takes a season to create a hybrid, and about 15 years to create a <u>Plant </u><u>va</u><u>r</u><u>iety.</u>
may this helps you
hope it's correct
bye
The surface area would be 25cm, while the vloume would be

or length×width×height
125cm cubed
Half life is the time that it takes for half of the original value of some amount of a radioactive element to decay.
We have the following equation representing the half-life decay:

A is the resulting amount after t time
Ao is the initial amount = 50 mg
t= Elapsed time
t half is the half-life of the substance = 14.3 days
We replace the know values into the equation to have an exponential decay function for a 50mg sample

That would be the answer for a)
To know the P-32 remaining after 84 days we have to replace this value in the equation:

So, after 84 days the P-32 remaining will be 0.85 mg
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Explanation:
The resonance compounds are compounds that have the same position of the atoms (same quantity and elements) but the position of the electrons arround them is different in each resonance compound.
In reality, the compound switches between all the resonance structures it has.
One example of resonance Lewis structures is the Ozone's as can be seen in the figure.