I suppose it false, since the oxidation involves the loss or removal of the electrons such forth it does not gain electrons.
168.96 g of carbon dioxide (CO₂)
Explanation:
The chemical reaction representing the combustion of acetylene:
2 C₂H₂ (g) + 5 O₂ (g)→ 4 CO₂ (g) + 2 H₂O (g)
number of moles = mass / molecular weight
number of moles of acetylene (C₂H₂) = 50 / 26 = 1.92 moles
Taking in account the stoichiometry of the chemical reaction, we devise the following reasoning:
if 2 moles of acetylene (C₂H₂) produces 4 moles of carbon dioxide (CO₂)
then 1.92 moles of acetylene (C₂H₂) produces X moles of carbon dioxide (CO₂)
X = (1.92 × 4) / 2 = 3.84 moles of carbon dioxide (CO₂)
mass = number of moles × molecular weight
mass of carbon dioxide (CO₂) = 3.84 × 44 = 168.96 g
Learn more about:
combustion of hydrocarbons
brainly.com/question/4919676
brainly.com/question/1406903
#learnwithBrainly
D has a total of four significant figures.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs