The heat that is released by the combustion of 3.5 moles of methane is 3115 kJ/mol.
<h3>What is a thermochemical equation?</h3>
A thermochemical equation is a reaction equation that incorporates the amount of heat lost/gained.
In this case, the reaction equation is; CH4 + O2 ----->CO2 + 2H2O dH = -890 kJ/mol
If 1 mole of methane releases 890 kJ/mol
3.5 moles of methane will release 3.5 moles * 890 kJ/mol/1 mole
= 3115 kJ/mol
Learn more about combustion reaction:brainly.com/question/12172040?
#SPJ1
2NH3 + H2O2 → N2H4 + 2H2O
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
<span>3) which is an example of a physical change
</span><span>a) grinding pepper</span>
Answer: The value of equilibrium constant for the given reaction is,
Explanation:
The given chemical equation is:
;
We need to calculate the equilibrium constant for the chemical equation, which is:
;
If the equation is revered then the equilibrium constant will be the reciprocal of the reaction.
If the equation is half then the equilibrium constant will be square-root of the reaction.
The value of equilibrium constant for the given reaction is:
Hence, the value of equilibrium constant for the given reaction is,