When perfume is sprayed in a room the particles of perfume diffuse with the particles in the air.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
You have a raw egg you put it in a hot pan boom cooked egg most chemical changes are nonreversibal <span />
Answer: has properties similar to other elements in group 18, does not react readily with other elements, is part of the noble gas group
Explanation: I’ve done on edg before