Water is not alive because it has no living organisms.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
D. one red straw and one green straw.
This problem is incomplete. Luckily, I found a similar problem from another website shown in the attached picture. The data given can be made to use through the Clausius-Clapeyron equation:
ln(P₂/P₁) = (-ΔHvap/R)(1/T₂ - 1/T₁)
where
P₁ = 14 Torr * 101325 Pa/760 torr = 1866.51 Pa
T₁ = 345 K
P₂ = 567 Torr * 101325 Pa/760 torr = 75593.78 Pa
T₂ = 441 K
ln(75593.78 Pa/1866.51 Pa) = (-ΔHvap/8.314 J/mol·K)(1/441 K - 1/345 K)
Solving for ΔHvap,
<em>ΔHvap = 48769.82 Pa/mol or 48.77 kPa/mol</em>