Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
You can pick up any garbage that you see. Talk to people and hear what their ideas are for helping the environmental.
If one starts with 0.020 g of Mg, 0.0008 moles of H2 would be made if the reaction is complete.
Going by the balanced equation of reaction in the image, 1 mole of Mg will produce 1 mole of H2 in a complete reaction.
If 0.020 g of Mg is started with:
mole of Mg = mass/molar mass
= 0.020/24.3
= 0.0008 moles
Since the mole of Mg to H2 is 1:1, thus, 0.0008 moles of H2 will also be made from the reaction.
More on stoichiometry can be found here: brainly.com/question/9743981
Answer:
In a chemical equilibrium, the forward and reverse reactions occur at equal rates, and the concentrations of products and reactants remain constant. A catalyst speeds up the rate of a chemical reaction, but has no effect upon the equilibrium position for that reaction.
Explanation: