The temperature in in Celsius is 5826.85 degree Celsius and Fahrenheit is 10520.33.
To express temperature in kelvin and Celsius two different relations are used, The formula to convert Fahrenheit to Celsius we use the formula T(K) = (T(°F) + 459.67)× 5/9 here T(k) mean temperature in kelvin and T(F) is temperature in Fahrenheit so by putting the given data we get (6100 − 273.15) × 9/5 + 32 = 10520.33°F and so now we obtained the temperature in kelvin so to convert kelvin to Celsius we use this formula °C=K−273.15, so by putting the given data 6100 − 273.15 = 5826.85°C.Kelvin, Celsius and Fahrenheit are the three units to measure the temperature.
To learn more about Temperature,
brainly.com/question/11464844
#SPJ4
The basic difference between chlorine and blench is that a natural element, while bleach is a solution of many elements.
Hope this help..
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
C2H4O2 + 2O2 —> 2CO2 + 2H20
The coefficients are 1, 2, 2, 2
Explanation:
C2H4O2 + O2 —> CO2 + H20
To balance the above, do the following
Since there are 2 carbon on the left, put 2 in front of CO2, we have
C2H4O2 + O2 —> 2CO2 + H20
We have 4 hydrogen on the left, to balance it put 2 in front of H2O i.e
C2H4O2 + O2 —> 2CO2 + 2H20
Now, we have a total of 6 oxygen on the right side. To balance it, put 2 in front of O2:
C2H4O2 + 2O2 —> 2CO2 + 2H20
The coefficients are 1, 2, 2, 2