D, you can't see ultraviolet rays and other similar frequency waves with the naked eye.
Answer : The one diagram which shows the electron with the highest potential energy is attached below.
Explanation : One can easily find the highest potential energy of the atom just by looking at the diagram, the electron which is from farthest distance from the atomic nucleus will have the highest potential energy in the electron.
Answer:
0.677 moles
Explanation:
Take the atomic mass of K = 39.1, O =16.0, P = 31.0
no. of moles = mass / molar mass
no. of moles of K3PO4 used = 4.79 / (39.1x3 + 31 + 16x4)
= 0.02256 mol
From the equation, the mole ratio of KOH : K3PO4 = 3 :1,
meaning every 3 moles of KOH used, produces 1 mole of K3PO4.
So, using this ratio, let the no. of moles of KOH required to be y.
y = 0.02256 x3
y = 0.0677 mol
If you don't find exactly 0.677 moles as one of the options, go for the closest one. A very slight error may occur because of taking different significant figures of atomic masses when calculating.
2H₂(g) + O₂(g) ⇄ 2H₂O(l)
Δngas = 0 - (2 +1)
= -3
<h3>
What is Δngas?</h3>
The number of moles of gas that move from the reactant side to the product side is denoted by the symbol ∆n or delta n in this equation.
Once more, n represents the growth in the number of gaseous molecules the equilibrium equation can represent. When there are exactly the same number of gaseous molecules in the system, n = 0, Kp = Kc, and both equilibrium constants are dimensionless.
<h3>
Definition of equilibrium</h3>
When a chemical reaction does not completely transform all reactants into products, equilibrium occurs. Many chemical processes eventually reach a state of balance or dynamic equilibrium where both reactants and products are present.
Learn more about Equilibrium
brainly.com/question/11336012
#SPJ4
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
