Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
When zinc is added to copper sulphate (CUSO4) solution due to more reactivity of zinc, cooper is replaced by the zinc and forms zinc sulphate. During the process, the colour of the solution changes from blue to colourless.
Answer:
Statements Y and Z.
Explanation:
The Van der Waals equation is the next one:
(1)
The ideal gas law is the following:
(2)
<em>where n: is the moles of the gas, R: is the gas constant, T: is the temperature, P: is the measured pressure, V: is the volume of the container, and a and b: are measured constants for a specific gas. </em>
As we can see from equation (1), the Van der Waals equation introduces two terms that correct the P and the V of the ideal gas equation (2),<u> by the incorporation of the intermolecular interaction between the gases and the gases volume</u>. The term an²/V² corrects the P of the ideal gas equation since the measured pressure is decreased by the attraction forces between the gases. The term nb corrects the V of the ideal gas equation, <u>taking into account the volume occuppied by the gas in the total volume, which implies</u> a reduction of the total space available for the gas molecules.
So, the correct statements are the Y and Z: the non-zero volumes of the gas particles effectively decrease the amount of "empty space" between them and the molecular attractions between gas particles decrease the pressure exerted by the gas.
Have a nice day!
Answer:
It can be spread into a smaller container
It can ve spread out into a larger container
It can be dissolved into a liquid