<h3><u>Answer;</u></h3>
B. It involves loss of electrons.
<h3><u>Explanation;</u></h3>
- Oxidation occurs when electrons are lost by an atom while reduction refers to the gain of electrons by an atom.
- <u><em>In this case, magnesium atom reacts with sulfur to form magnesium sulfide by loosing two electrons and forming magnesium ion (Mg2+). Therefore magnesium undergoes oxidation.</em></u>
- Sulfur, on the other hand will gain electrons to form Sulfide ions, therefore it undergoes reduction.
- Therefore;<em><u> In magnesium sulfide (MgS), magnesium loses two electrons and becomes a cation with a positive-two charge. Likewise, sulfur obtains the two electrons lost from magnesium and becomes an anion with a negative-two charge. However, the overall charge of MgS is zero.</u></em>
Answer:
1. equator
2. west to east
3. equator
4. north to south
5. hemisphears
Explanation:
Mark as brainliest please
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
A. Identify the properties as either a physical or chemical property. (first 3 are chemical, last is physical)
Answer:
B.9.710-11M
Explanation:
<h3>plss tell me if im wrong</h3>
