Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Answer:
Explanation:
7A 0.2
7B cork
7C Yes because the lighter it is the more likely it will float
7D Density is one of the fundamental scientific principles of life. It can describe any everyday object. Despite its significance, students often struggle to understand what it really is. Density is a measurement of how much space or volume is packed in an object or substance.
8 property means a characteristic or trait that you can use to describe matter by observation, measurement, or combination.
<span>any electrolyte that is not easily reduced or oxidized</span>
Answer:
Increasing the temperature will cause chemical changes to occur faster. Decreasing the temperature, causes the particles to lose energy which causes them to move around less and slower. The less they move, the less collisions occur, and the less reactions occur between the chemicals = slower reaction rate.
Explanation:
Answer:225000 milliliters
Hope this helps.Sorry id you get this wrong
