All categories

2 years ago

17. Which of the following represent the correct net ionic equations from the double replacement reaction of

Chemistry

1 answer:

Kisachek [45]2 years ago

3 0

Answer:

D. 2 NO3(aq)+Ca2+

Explanation:

You might be interested in

Select the more electronegative element in each pair.a.Cl or Fb.Se or Oc.N or Asd.Na or Mg

liubo4ka [24]

Answer:

The answer to your question is below

Explanation:

Electronegativity is a measure of how strongly atoms attract electrons to themselves.

Process

Look for the electronegativity of each element and compare.

a) Cl = 3.16 F = 3.98 Fluorine has a higher electronegativity

b) Se = 2.55 O = 3.44 Oxygen has a higher electronegativity

c) N = 3.04 As = 2.18 Nitrogen has a higher electronegativity

d) Na = 0.93 Mg = 1.31 Magnesium has a higher electronegativity

6 0

2 years ago

When dissolved in water, a neutral molecule of calcium chloride dissociates into three ions - one calcium ion and two chloride i

Mashcka [7]

Explanation:

Calcium chloride is an ionic compound as it is formed by transfer of an electron to each chlorine atom.

So, being an ionic compound calcium chloride is able to dissociate completely into water.

Hence, the dissociation reaction will be as follows.

$CaCl_{2}(s) \rightarrow Ca^{2+}(aq) + 2Cl^{-}(aq)$

Since, two electrons has been lost by single calcium atom. Therefore, calcium atom will have a charge of +2.

Thus, we can conclude that the charge on the calcium ion, in elementary units is +2.

8 0

2 years ago

Carbon dioxide (CO2) is a gaseous compound. Calculate the percent composition of this compound. Answer using three significant f

Tamiku [17]

Carbon dioxide is a gaseous molecule made up of the elements, C and O. Each mole of carbon dioxide has one mole C and two mole oxygen atoms.

Molar mass of carbon dioxide ( $CO_{2}$ )= $(1 * 12.01\frac{g}{mol}) +(2* 16\frac{g}{mol})=44.01\frac{g}{mol}$

Percentage by mass of carbon = $\frac{(1*12.01\frac{g}{mol}) }{44.01\frac{g}{mol} } *100=27.3%$

Percentage by mass of oxygen = $\frac{(2*16\frac{g}{mol})}{44.01\frac{g}{mol} } *100=72.7%$

Therefore C is 27.3 % and O is 72.7 % by mass in 1 mol CO $_{2}$

7 0

3 years ago

Read 2 more answers

What type of stress results when two plates push against one another?

Natasha2012 [34]

When two plates push against each other shear stress will happem because they move in opposite directions. In this case the force of the stress pushes some of the crust in different directions. When this happens, a large part of the crust can break off, which makes the plate size smaller.

3 0

2 years ago

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

2 years ago