When ΔG° is the change in Gibbs free energy
So according to ΔG° formula:
ΔG° = - R*T*(㏑K)
here when K = [NH3]^2/[N2][H2]^3 = Kc
and Kc = 9
and when T is the temperature in Kelvin = 350 + 273 = 623 K
and R is the universal gas constant = 8.314 1/mol.K
So by substitution in ΔG° formula:
∴ ΔG° = - 8.314 1/ mol.K * 623 K *㏑(9)
= - 4536
Answer:
what is that i connot understand your question
Explanation:
im sorry i connot answer your question
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer is: Ksp for silver sulfide is 8.00·10⁻⁴⁸.
Reaction
of dissociation: Ag₂S(s) → 2Ag⁺(aq) + S²⁻(aq)<span>.
</span>s(Ag₂S) = s(S²⁻) = 1.26·10⁻¹⁶ M.
s(Ag⁺) = 2s(Ag₂S) = 2.52·10⁻¹⁶ M; equilibrium concentration of silver cations.
Ksp = s(Ag⁺)² · s(S²⁻).
Ksp = (2.52·10⁻¹⁶ M)² · 1.26·10⁻¹⁶ M.
Ksp = 6.35·10⁻³² M² · 1.26·10⁻¹⁶ M.
Ksp = 8.00·10⁻⁴⁸ M³.
