Answer:
The three laws of Chemical Reaction are .The law of constant proportions. The law of multiple proportions. The law of reciprocal proportions.
A chemical compound is always found to be made up of the same elements combined together in the same fixed proportion by mass.
potassium and chlorine gas ---> chloride.
Hope this helps, have a good day.✌
Answer:
The type of reaction is a single-replacement reaction.
Explanation:
Mg switches places with H, leaving H by itself.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
For instance equation C6H5C2H5 + O2 = C6H5OH + CO2 + H2O will not be balanced, but PhC2H5 + O2 = PhOH + CO2 + H2O will; Compound states [like (s) (aq) or (g)] are not required. If you do not know what products are enter reagents only and click 'Balance'. In many cases a complete equation will be suggested.
Explanation:
Answer:
½O 2 + 2e - + H 2O → 2OH.
Explanation:
Redox reactions - Higher
In terms of electrons:
oxidation is loss of electrons
reduction is gain of electrons
Rusting is a complex process. The example below show why both water and oxygen are needed for rusting to occur. They are interesting examples of oxidation, reduction and the use of half equations:
iron loses electrons and is oxidised to iron(II) ions: Fe → Fe2+ + 2e-
oxygen gains electrons in the presence of water and is reduced: ½O2 + 2e- + H2O → 2OH-
iron(II) ions lose electrons and are oxidised to iron(III) ions by oxygen: 2Fe2+ + ½O2 → 2Fe3+ + O2-
