Sorry for the late response but for this question, the answer is 3 moles of water.
Answer:
Distribution coefficient: 4.79
Explanation:
Distribution coefficient is the ratio between equilibrium concentration of non-aqueous phase and aqueous phase where both solvents are inmiscible. The equation for the problem is:
Distribution coefficient: Concentration in chloroform / Concentration in Water
<em>Concentration in water: 2.59mg / 30mL = 0.08633mg/mL</em>
<em>Concentration in chloroform: (15mg-2.59mg) / 30mL = 0.4137mg/mL</em>
<em />
Distribution coefficient: 0.4137mg/mL / 0.08633mg/mL
<h3>Distribution coefficient: 4.79</h3>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
It depends on what unit/subject you're looking at.
Because in physics, I know that if you are considering Newton's theory of particles, all particles technically go in a straight line from the original direction. BUT, if you're looking at the Wave of the Particle theory, then you would assume that particles do not necessarily follow the above b/c they follow the properties of a wave...
Answer:
85 cents/L is equal to 3.2176$/gallon.
gas wiuld be heaper to buy from the station A.
Explanation:
As 85 cents/L is more than $2.5/gallon therefore buying gas from station A would be cheaper than the other one.
