The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer: a. 0.26mol
b. 0.000479mol
c. 1.12mol
Explanation: Please see attachment for explanation
One of the many ways in order to solve for the vapor pressure of pure components at a given temperature is through the Antoine's equation which is written below,
P = 10^(A - B/C+T)
where A, B, and C are constants and T is the temperature in °C and P is the vapor pressure in mm Hg.
For hexane,
A = 7.01
B = 1246.33
C = 232.988
Substituting the known values,
P = 10^(7.01 - 1246.33/232.988+25)
<em> P = 151.199 mm Hg</em>