Answer:
2 H⁺ + 2e = H₂ ( reduction )
Explanation:
Fe( s ) + 2 CH₃COOH = Fe ( OOCCH₃ ) ₂ + H₂
Fe( s ) = Fe⁺² + 2e ( oxidation )
2 H⁺ + 2e = H₂ ( reduction )
Answer:
1. some thing that has matter is an apple, a person,a table. things that does 2.not Light.,Sound.,Heat.Energy.Gravity.Time.A Rainbow.Love.
3. Physical changes only change the appearance of a substance, not its chemical composition. Chemical changes cause a substance to change into an entirely substance with a new chemical formula. Chemical changes are also known as chemical reactions.
4.A chemical reaction is usually accompanied by easily observed physical effects, such as the emission of heat and light, the formation of a precipitate, the evolution of gas, or a color change. Absolute confirmation of a chemical change can only be validated by chemical analysis of the products!
5.Precipitate: In chemistry, a solid formed by a change in a solution, often due to a chemical reaction or change in temperature that decreases solubility of a solid. In meteorology a precipitate is liquid or solid water (rain, snow, etc.) falling from the sky.
6.n simple terms, the endothermic reactions absorb energy from the surrounding that is in the form of heat. On the other hand, an exothermic reaction releases energy into the surrounding of the system.
hope this help plz give me a thxs and brainlyest and a five star thx and you welcome let me know if this helped
Explanation:
Answer:1) Volume of 
required is 55.98 mL.
2) 0.62577 grams of 
is produced.
Explanation:
1) Molarity of 
Volume of 
Molarity of 
Volume of 
According to reaction, 1 mole of 
reacts with 3 mole of , then, 0.0041985 moles of will react with:
moles of that is 0.0125955 moles.
Volume of required is 55.98 mL.
2)
Number of moles of 
According to reaction, 3 moles of gives 1 mole of , then 0.004485 moles of will give:
moles of that is 0.001495 moles.
Mass of =
Moles of × Molar Mass of
= 0.001495 moles × 418.58 g/mol = 0.62577 g
0.62577 grams of is produced.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
-The stronger electrostatic forces of attraction between the oppositely charged ions causes the Sodium chloride to break apart until it completely dissolves in the water.
Explanation:
-Sodium Chloride has positively charged sodium ions, 
and negatively charged chloride ions, 
.
-Water on the other hand has positively charged Hydrogen ions,
and negatively charged Oxygen ions, 
due to the difference in electroneganivity.
-When dissolved in water, the positively charged sodium ions will attract the partially negatively charged oxygen ions. The negatively charged chloride ions will be attracted to the positively charged hydrogen ions in the reaction as below:
