The amount of heat energy needed to convert 400 g of ice at -38 °C to steam at 160 °C is 1.28×10⁶ J (Option D)
<h3>How to determine the heat required change the temperature from –38 °C to 0 °C </h3>
- Mass (M) = 400 g = 400 / 1000 = 0.4 Kg
- Initial temperature (T₁) = –25 °C
- Final temperature (T₂) = 0 °
- Change in temperature (ΔT) = 0 – (–38) = 38 °C
- Specific heat capacity (C) = 2050 J/(kg·°C)
- Heat (Q₁) =?
Q = MCΔT
Q₁ = 0.4 × 2050 × 38
Q₁ = 31160 J
<h3>How to determine the heat required to melt the ice at 0 °C</h3>
- Mass (m) = 0.4 Kg
- Latent heat of fusion (L) = 334 KJ/Kg = 334 × 1000 = 334000 J/Kg
- Heat (Q₂) =?
Q = mL
Q₂ = 0.4 × 334000
Q₂ = 133600 J
<h3>How to determine the heat required to change the temperature from 0 °C to 100 °C </h3>
- Mass (M) = 0.4 Kg
- Initial temperature (T₁) = 0 °C
- Final temperature (T₂) = 100 °C
- Change in temperature (ΔT) = 100 – 0 = 100 °C
- Specific heat capacity (C) = 4180 J/(kg·°C)
- Heat (Q₃) =?
Q = MCΔT
Q₃ = 0.4 × 4180 × 100
Q₃ = 167200 J
<h3>How to determine the heat required to vaporize the water at 100 °C</h3>
- Mass (m) = 0.4 Kg
- Latent heat of vaporisation (Hv) = 2260 KJ/Kg = 2260 × 1000 = 2260000 J/Kg
- Heat (Q₄) =?
Q = mHv
Q₄ = 0.4 × 2260000
Q₄ = 904000 J
<h3>How to determine the heat required to change the temperature from 100 °C to 160 °C </h3>
- Mass (M) = 0.4 Kg
- Initial temperature (T₁) = 100 °C
- Final temperature (T₂) = 160 °C
- Change in temperature (ΔT) = 160 – 100 = 60 °C
- Specific heat capacity (C) = 1996 J/(kg·°C)
- Heat (Q₅) =?
Q = MCΔT
Q₅ = 0.4 × 1996 × 60
Q₅ = 47904 J
<h3>How to determine the heat required to change the temperature from –38 °C to 160 °C</h3>
- Heat for –38 °C to 0°C (Q₁) = 31160 J
- Heat for melting (Q₂) = 133600 J
- Heat for 0 °C to 100 °C (Q₃) = 167200 J
- Heat for vaporization (Q₄) = 904000 J
- Heat for 100 °C to 160 °C (Q₅) = 47904 J
- Heat for –38 °C to 160 °C (Qₜ) =?
Qₜ = Q₁ + Q₂ + Q₃ + Q₄ + Q₅
Qₜ = 31160 + 133600 + 167200 + 904000 + 47904
Qₜ = 1.28×10⁶ J
Learn more about heat transfer:
brainly.com/question/10286596
#SPJ1
A moon would be the correct answer.
Answer:
Chemical bonds are the electrical forces of attraction that hold atoms or ions together to form molecules. Different types of chemical bonds and their varying intensity are directly responsible for some of the physical properties of minerals such as hardness, melting and boiling points, solubility, and conductivity.
Explanation:
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Adenine , guanine, cytosine and thymine
