Answer:
1. A. The plant leans toward window.
Explanation:
Plants need light to perform photosynthesis and live. Therefore, this means the plant will always lean toward light in order to survive.
- Hope that helps! Please let me know if you need further explanation.
Answer:
Molecular formula
Explanation:
Molecular formula in the first place is required to understand which compound we have. We then should refer to the periodic table and find the molecular weight for each atom. Adding individual molecular weights together would yield the molar mass of a compound.
Then, dividing the total molar mass of a specific atom by the molar mass of a compound and converting into percentage will provide us with the percentage of that specific atom.
E. g., calculate the percent composition of water:
- molecular formula is ;
- calculate its molar mass: [tex]M = 2M_H + M_O = 2\cdot 1.00784 g/mol + 16.00 g/mol = 18.016 g/mol;
- find the percentage of hydrogen: [tex]\omega_H = \frac{2\cdot 1.00784 g/mol}{18.016 g/mol}\cdot 100 \% = 11.19 %;
- find the percentage of oxygen: [tex]\omega_O = \frac{16.00 g/mol}{18.016 g/mol}\cdot 100 \% = 88.81 %.
Which solution is the least concentrated?
O 2 moles of solute dissolved in 4 liters of solution
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3