CH3CHClCH(CH3)CH2CH2CH2CH2Br name the molecule iupac rules please
1 answer:
You might be interested in
Answer:
Explanation:-
Single replacement reaction is a chemical reaction in which more reactive element displaces the less reactive element from its salt solution.
As zinc is more reactive than copper, it could easily displace copper from its aqueous solution and thus leads to formation of zinc (II) sulfate and pure copper.
The chemical reaction can be represented as :
The phases are represented as (s) for solid sate, (l) for liquid state, (g) for gaseous state and (aq) for aqueous state.
The reaction creates dihydrogen, hence if it's uncontrolled it could lead to potentially dangerous amounts of gas being released at once.