Two or more different elements
that's your work bro do by your own
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Explanation:
use the equation
moles = mass/mr
=19.9/79.5
=0.250moles of CuO
then do the same for
H = 2.02/1
=2.02
so CuO is the limiting reagent because there is less amount of it.
Hope this helps :)
500,000 g of baking soda is present in 1000 boxes of 500 g baking soda boxes.
Answer:
Option C.
Explanation:
As 500 g of baking soda is taken in each box of that company. The total weight of baking soda in all the boxes can be determined by adding the weights of each box. This is possible only when the number of boxes is less. But if the number of boxes are large, then we can determine the total weight of baking soda by multiplying the number of boxes with the weight in each box.
So in this case, 1000 boxes are present and in that 500 g of baking soda are present in each box.
So total grams of baking soda will be 1000 * 500 = 5,00,000 g.
Thus, 500,000 g of baking soda is present in 1000 boxes of 500 g baking soda boxes.
