Answer:
Explanation:
The direct reaction of a carboxylic acid with an amine would be expected to be difficult because the basic amine would deprotonate the carboxylic acid to form a highly unreactive carboxylate. However when the ammonium carboxylate salt is heated to a temperature above 100 C water is driven off and an amide is formed.
The short run refers to a period of time short enough so that the amounts of at least one or more of the factors of production used by the firm cannot be changed. ... By the long run we mean a period of time long enough so that the amounts of all factors of production used by the firm can be changed.
There’s lots of measurements. (m, kg, s, mol, cm, in, mm) etc
Answer:
remaining still during the night.
Explanation:
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane