Answer:
characteristic properties of an element are the defining properties of that element and it does not change with quantity of the element used.
Explanation:
the amount or the quantity of the element used does not affect the characteristic property of the element. it does not matter is the if the amount or the quantity of the element used in the reaction is large or the small the characteristic properties like boiling point, melting point, density, thermal conductivity, etc remain the same or remain constant.
You just have to find a conversion from amu to grams. For every 1 amu, there is 1.66×10⁻²⁴ grams. Thus,
Mass of proton = 1.0073 amu * 1.66×10⁻²⁴ grams/amu = 1.672×10⁻²⁴ grams
Since a proton is spherical in shape, the volume would be:
Volume = 1/6*πd³ = 1/6*π(1.0×10⁻¹⁵ cm)³ = 5.236×10⁻⁴⁶ cm³
Therefore, the density is equal to
Density = Mass/Volume = 1.672×10⁻²⁴ grams/5.236×10⁻⁴⁶ cm³
Density = 3.2×10²¹ g/cm³
Answer:
6 moles of oxygen
Explanation:We can find from the chemistry equation
C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)
6 moles O2 ~4 moles H2O
Answer:
1935100 Bq
Explanation:
Let us recall that:
If 1 μCi can be equivalent to 37000 Bq
Then; the activity of 52.3 μCi will be:
The mass of one atom of Carbon is 2.0×10^−26 kg.
The mass of the period mark(kg)= 1.0x10^-7 kg.
# of carbon atoms=1x10^-7/2x10^-26
# of carbon atoms= 5x10^-34
