Answer:
Explanation:
Hello there!
In this case, according to the rules for the oxidation states in chemical reactions, it is possible to realize that lone elements have 0 and since magnesium is in group 2A, it forms the cation Mg⁺² as it loses electrons and oxygen is in group 6A so it forms the anion O⁻²; therefore resulting oxidation numbers are:
Best regards!
Answer:
The correct answer is Sugar has a greater solubility than sand.
Sugar will easily dissolve in water because it has a lower density than sand, therefore it has a greater solubility.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Mass = 18.9 g
Explanation:
Given data:
Mass of Al₂O₃ formed = ?
Mass of Al = 10.0 g
Solution:
Chemical equation:
4Al + 3O₂ → 2Al₂O₃
Number of moles of Al:
Number of moles = mass/molar mass
Number of moles = 10.0 g/ 27 g/mol
Number of moles = 0.37 mol
Now we will compare the moles of Al and Al₂O₃.
Al : Al₂O₃
4 : 2
0.37 : 2/4×0.37 = 0.185 mol
Mass of Al₂O₃:
Mass = number of moles × molar mass
Mass = 0.185 mol × 101.9 g/mol
Mass = 18.9 g
Answer:
a) C6H5COOH + H2O ↔ H3O+ + C6H5COO-
b) [ H3O+ ] = 2.517 E-3 M
c) pH = 2.599
Explanation:
a) balanced equation:
C6H5COOH + H2O ↔ H3O+ + C6H5COO-
⇒ Ka = ( [ H3O+ ] * [ C6H5COO- ] ) / [ C6H5COOH ] = 6.5 E-5
mass balance:
0.10 m = [ C6H5COO- ] + [ C6H5COOH ].....(1)
charge balance:
[ H3O+ ] = [ C6H5COO- ] + [ OH- ] .......[ OH- ] : comes from water, it's not significant
⇒ [ H3O+ ] = [ C6H5COO- ] .........(2)
b) (2) in (1):
⇒ 0.10 M = [ H3O+ ] + [ C6H5COOH ]
⇒ [ C6H5COOH ] = 0.10 - [ H3O+ ]
⇒ Ka = [ H3O+ ]² / ( 0.1 - [ H3O+ ] ) = 6.5 E-5
⇒ [ H3O+ ]² + 6.5 E-5 [ H3O+ ] - 6.5 E-6 = 0
⇒ [ H3O+ ] = 2.517 E-3 M
c) pH = - log [ H3O+ ]
⇒ pH = - Log ( 2.517 E-3 )
⇒ pH = 2.599
