It’s the the 3rd one because equilibrium actually mean it’s equal or the same
Answer:
An atom containing 11 electrons
Explanation:
Metal atoms form ions by a loss of electrons whereas non-metal atoms form ions by the gain of electrons.
The group 1 elements or alkali metals form lose their one valence shell electrons when forming ions; Group 2 metals lose two while Group 3 lose three. On the other hand, non-metal atoms found in Group 5, 6, and 7 forms ions by gaining one, two and three electrons respectively.
Using the electronic configuration of atoms, their groups in the Periodic Table can be determined.
An atom containing 6 electrons has the configuration 2,4 and thus belongs to Group 4.
An atom with 2 electrons belongs to Group 2
An atom with 11 electrons has the configuration 2,8,1 and thus belongs to Group 1
An atom with 10 electrons has the configuration 2,8 and thus belongs to Group 8
An atom with 8 electrons has the configuration 2,6 and thus belongs to Group 6.
From the above, it can be seen that an atom containing 11 electrons belongs to Group 1 and will lose an electron to form an ion.
Answer:
Chemical energy.
Explanation:
This is biology btw, not chemistry
Answer:
<u>5 moles S x (36.02 g S/mole S) = 180.1 grams of S</u>
Explanation:
The periodic table has mass units for every element that can be correlated with the number of atoms of that element. The relationship is known as Avogadro's Number. This number, 6.02x
, is nicknamed the mole, which scientists found to be a lot more catchy, and easier to write than 6.02x. <u>The mole is correlated to the atomic mass of that element.</u> The atomic mass of sulfur, S, is 36.02 AMU, atomic mass units. <u>But it can also be read as 36.02 grams/mole.</u>
<u></u>
<u>This means that 36.02 grams of S contains 1 mole (6.02x</u><u>) of S atoms</u>.
<u></u>
This relationship holds for all the elements. Zinc, Zn, has an atomic mass of 65.38 AMU, so it has a "molar mass" of 65.38 grams/mole. ^5.38 grams of Zn contains 1 mole of Zn atoms.
And so on.
5.0 moles of Sulfur would therefore contain:
(5.0 moles S)*(36.02 grams/mole S) = <u>180.1 grams of S</u>
Note how the units cancel to leaves just grams. The units are extremely helpful in mole calculations to insure the correct mathematical operation is done. To find the number of moles in 70 g of S, for example, we would write:
(70g S)/(36.02 grams S/mole S) = 1.94 moles of S. [<u>Note how the units cancel to leave just moles</u>]
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
