Answer:
This question appears incomplete
Explanation:
This question appears incomplete because the data provided only makes it possible to calculate the certainty of the acetic acid content per total volume of the vinegar. Thus, the 4% means for every 100 mL of the vinegar, there is 4 mL of acetic acid present. To calculate the volume of acetic acid in any other volume of vinegar, the formula will be
volume of acetic acid = 4/100 × total volume of vinegar
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The correct answer is 0.12 grams.
Explanation:
The mass of carbon monoxide or CO collected in the tube can be determined by using the ideal gas equation, that is, PV = nRT.
Based on the given question, P or the pressure of the gas is given as 1 atm, volume of the gas collected in the tube is 117 ml or 0.117 L.
The number of moles or n can be determined by using the equation, mass/molar mass.
R is the universal gas constant, whose value is 0.0821 L atmK^-1mol^-1, and temperature is 55 degree C or 328 K (55+273).
On putting the values we get:
n = PV/RT
= (1 atm*0.117 L) / (0.0821 L atmK^-1mol^-1 * 328 K)
= 0.0043447 mol
Therefore, mass of CO will be moles * molar mass of CO
= 0.0043447 mol * 28 g/mol
= 0.12 g
Answer:
It is better to do chemistry
Explanation:
So that you will learn more of chemicals