All categories

1 year ago

A particle moving at speed 0. 32 c has momentum p0. the speed of the particle is increased to 0. 72 c. what is its momentum now?

1 answer:

6 0

A particle moving at speed 0.32 c has momentum P₀. the speed of the particle is increased to 0.72 c then its momentum would be 2.25P₀.

<h3>What is momentum?</h3>

It can be defined as the product of the mass and the speed of the particle, it represents the combined effect of mass and the speed of any particle, and the momentum of any particle is expressed in Kg m/s unit.

Mathematically the formula of the momentum is

P = mv

where P is the momentum of the particle

m is the mass of the particle

v is the velocity by which the particle is moving

As given in the question a particle moving at speed 0.32 c has momentum P₀. the speed of the particle is increased to 0.72 c

by using the formula of the momentum and substituting the values of the velocity

P =mv

As mentioned in the question when the particle is moving with 0.32c velocity it has a momentum of P₀

P₀ = m*(0.32c)

If the speed of the particle is increased to 0.72 c the momentum would be

P=m*(0.72c)

by dividing the second equation from the first one

P₀/P = 0.32c/0.72c

P₀/P = 0.44

P =2.25P₀

Thus, the increased momentum of the particle would be 2.25P₀

Learn more about momentum from here

brainly.com/question/17662202

#SPJ4

You might be interested in

A thin-walled cylindrical pressure vessel is subjected to an internal gauge pressure, p=75 psip=75 psi. It had a wall thickness

Mekhanik [1.2K]

To solve this problem we must apply the concept related to the longitudinal effort and the effort of the hoop. The effort of the hoop is given as

$\sigma_h = \frac{Pd}{2t}$

Here,

P = Pressure

d = Diameter

t = Thickness

At the same time the longitudinal stress is given as,

$\sigma_l = \frac{Pd}{4t}$

The letters have the same meaning as before.

Then he hoop stress would be,

$\sigma_h = \frac{Pd}{2t}$

$\sigma_h = \frac{75 \times 8}{2\times 0.25}$

$\sigma_h = 1200psi$

And the longitudinal stress would be

$\sigma_l = \frac{Pd}{4t}$

$\sigma_l = \frac{75\times 8}{4\times 0.25}$

$\sigma_l = 600Psi$

The Mohr's circle is attached in a image to find the maximum shear stress, which is given as

$\tau_{max} = \frac{\sigma_h}{2}$

$\tau_{max} = \frac{1200}{2}$

$\tau_{max} = 600Psi$

Therefore the maximum shear stress in the pressure vessel when it is subjected to this pressure is 600Psi

6 0

3 years ago

Your friend says, “chemical changes are caused by an input in energy. In physical changes, there is no transfer of energy” is yo

nalin [4]

Answer:

Ok, let's suppose the simplest of the physical changes:

We have an object that is not moving (so it is not accelerated)

and there is change, now the object moves.

Because there was a change, means that there was an acceleration, and by the second Newton's law.

Force equals mass times acceleration:

F = m*a

There must be a force.

So suppose that you pushed the object, then some energy that you had, you transferred it to the object, that now is moving and now has kinetic energy.

Now, is kinda true that in a closed system the total energy is always constant, but it depends on what is our system.

So if we think in our system as you and the object, then in the whole system the energy does not change because the energy that you lost is now on the object, but again, there was a transfer of energy.

So no, your friend is not correct.

3 0

3 years ago

Matter compromises of all of them which is independent

babymother [125]

Answer:

elementary particles

Explanation:

Matter is composed of elementary particles i.e. quarks and leptons.

Matter is composed of elementary particles which is called quarks and leptons. Quarks consist of protons, neutrons and electrons. All observable matter is made up of up quarks, down quarks and electrons.

Lepton is an elementary particle consist of half-integer spin that does not undergo strong interactions. Leptons exist on two main classes i.e. charged leptons, and neutral leptons. Electron, electron neutrino, muon, muon neutrino, tau and tau neutrino are the six types of leptons.

4 0

2 years ago

Give a description for each of the following: Polar bear, Caribou, Arctic Fox, Arctic Hare, Snowy Owl, Musk Ox, and Rock Ptarmig

nevsk [136]

Polar Bear-Carnivorous bear
Caribou-Also known as reindeer, herbivorous
Arctic Fox-White fox from arctic tundra
Arctic Hare-Polar rabbit, live in North American tundra
Snowy Owl-Large, white owl. Younger= darker plumage
Musk Ox-<span>Arctic mammal of the family Bovidae</span>
Rock Ptarmigan-Medium sized bird

4 0

3 years ago

Read 2 more answers

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.

Shkiper50 [21]

C = 5/9 (F-32)Part 1. C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

4 0

3 years ago

Read 2 more answers