Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(c
1 answer:
You might be interested in
Answer:
Explanation:
<u>According to Arrhenius concept of acid and base:</u>
"When a base in a solution, produces/yields OH- (Hydroxide) ions."
So, when a base is dissolved in a solution, it produces OH- ions.
<u>For example:</u>
NaOH ⇄ Na⁺ + OH⁻ (So, it is a base)
Hope this helped!
<h3>~AH1807</h3>
Answer:- 1.24 g
Solution:- The balanced equation for the formation of carbonic acid by the reaction of carbon dioxide with water is:
From balanced equation, there is 1:1 mol ratio between carbon dioxide and carbonic acid. So, moles of carbonic acid will be equal to the moles of carbon dioxide used.
Moles of carbon dioxide can be calculated using ideal gas law equation as it's volume, temperature and pressure are given.
we need to convert mL to L, degree C to kelvin and kilopascals to atm.
= 0.495 L
25 + 273 = 298 K
= 1 atm
Ideal gas law equation is:
PV = nRT
We want to find out the n, so let's rearrange this:
R is the universal gas constant and it's value is .
Let's pug in the values in the equation and solve it for n.
n = 0.02 mol
To convert the moles to grams we multiply the moles by the molar mass of carbonic acid.
Molar mass of carbonic acid = 2(1.008)+12.01+3(16.00)
= 2.016+12.01+48.00
= 62.03 gram per mol (rounded to two decimal places)
Let's multiply the moles by molar mass:
= 1.24 g
So, the theoretical yield of carbonic acid is 1.24 g.