Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(c
1 answer:
You might be interested in
Answer:
In Cl, the 2 is a subscript because it indicates there are 2 of the same elements. The Lewis structure would display it as Cl-Cl.
On the other hand, a superscript would indicate a specific charge.
All subscripts show the amount of the specific element there is.
An example would be O or N
, they both show that there are 2 of the same elements.
If the subscript is outside a parenthesis such as it indicates there are 2
molecules.