Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer is: carbon.
<span>During gamma emission the nucleus emits radiation without
changing its composition, if for example have nucleus with six
protons and six neutrons (carbon atom) and after gamma decay there
is nucleus with six protons and six neutrons.
Gamma rays are the electromagnetic waves with
the shortest wavelengths (1 pm), highest frequencies (300 EHz) and
highest energy (1,24 MeV).</span>
<span><span>There is no formula. The speed of light is a fundamental constant which appears in other formulas but there’s no formula to compute the numerical value.Well, actually, that’s not quite right. The numerical value in meters per second is known exactly, because we use the speed of light to define the meter. It is: <span><span><span>c=299,792,458 m/s</span><span>c=299,792,458 m/s</span></span>
</span>. Exactly. But the thing is — this value is purely an artifact of our unit system. Other unit systems will give other values, so the number value is entirely arbitrary.</span></span>
Answer:
Mass of chemical = 1.5 mg
Explanation:
Step 1: First calculate the concentration of the stock solution required to make the final solution.
Using C1V1 = C2V2
C1 = concentration of the stock solution; V1 = volume of stock solution; C2 = concentration of final solution; V2 = volume of final solution
C1 = C2V2/V1
C1 = (6 * 25)/ 0.1
C1 = 1500 ng/μL = 1.5 μg/μL
Step 2: Mass of chemical added:
Mass of sample = concentration * volume
Concentration of stock = 1.5 μg/μL; volume of stock = 10 mL = 10^6 μL
Mass of stock = 1.5 μg/μL * 10^6 μL = 1.5 * 10^6 μg = 1.5 mg
Therefore, mass of sample = 1.5 mg
